C29H42F2N5O9P — CID 166880677
benzyl 2-[[[(2R,3R,5R)-4,4-difluoro-3-hydroxy-5-[2-oxo-4-(propan-2-ylamino)pyrimidin-1-yl]oxolan-2-yl]methoxy-(3-morpholin-4-ylpropoxy)phosphoryl]amino]propanoate (PubChem CID 166880677) has the molecular formula C29H42F2N5O9P and a molecular weight of 673.65 g/mol. Its IUPAC name is benzyl 2-[[[(2R,3R,5R)-4,4-difluoro-3-hydroxy-5-[2-oxo-4-(propan-2-ylamino)pyrimidin-1-yl]oxolan-2-yl]methoxy-(3-morpholin-4-ylpropoxy)phosphoryl]amino]propanoate.
| Compound Name | benzyl 2-[[[(2R,3R,5R)-4,4-difluoro-3-hydroxy-5-[2-oxo-4-(propan-2-ylamino)pyrimidin-1-yl]oxolan-2-yl]methoxy-(3-morpholin-4-ylpropoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166880677 |
| Molecular Formula | C29H42F2N5O9P |
| Molecular Weight | 673.65 g/mol |
| Exact Mass | 673.27 |
| IUPAC Name | benzyl 2-[[[(2R,3R,5R)-4,4-difluoro-3-hydroxy-5-[2-oxo-4-(propan-2-ylamino)pyrimidin-1-yl]oxolan-2-yl]methoxy-(3-morpholin-4-ylpropoxy)phosphoryl]amino]propanoate |
| SMILES | CC(C)Nc1ccn([C@@H]2O[C@H](COP(=O)(NC(C)C(=O)OCc3ccccc3)OCCCN3CCOCC3)[C@@H](O)C2(F)F)c(=O)n1 |
| InChI | InChI=1S/C29H42F2N5O9P/c1-20(2)32-24-10-12-36(28(39)33-24)27-29(30,31)25(37)23(45-27)19-44-46(40,43-15-7-11-35-13-16-41-17-14-35)34-21(3)26(38)42-18-22-8-5-4-6-9-22/h4-6,8-10,12,20-21,23,25,27,37H,7,11,13-19H2,1-3H3,(H,34,40)(H,32,33,39)/t21?,23-,25-,27-,46?/m1/s1 |
| InChIKey | UTLJCMGXYFPMHP-YLODYFPISA-N |
| XLogP | 2.54 |
| TPSA | 162.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.65 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|