C24H27N — CID 153334393
3-(3,4-dimethylphenyl)-N-methyl-1-(4-methylnaphthalen-1-yl)butan-1-imine (PubChem CID 153334393) has the molecular formula C24H27N and a molecular weight of 329.49 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-N-methyl-1-(4-methylnaphthalen-1-yl)butan-1-imine.
| Compound Name | 3-(3,4-dimethylphenyl)-N-methyl-1-(4-methylnaphthalen-1-yl)butan-1-imine |
|---|---|
| PubChem CID | 153334393 |
| Molecular Formula | C24H27N |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-N-methyl-1-(4-methylnaphthalen-1-yl)butan-1-imine |
| SMILES | C/N=C(\CC(C)c1ccc(C)c(C)c1)c1ccc(C)c2ccccc12 |
| InChI | InChI=1S/C24H27N/c1-16-10-12-20(14-18(16)3)19(4)15-24(25-5)23-13-11-17(2)21-8-6-7-9-22(21)23/h6-14,19H,15H2,1-5H3/b25-24+ |
| InChIKey | OOQLWIPGJFYWAG-OCOZRVBESA-N |
| XLogP | 6.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|