About CID 22401841
CID 22401841 (PubChem CID 22401841) has the molecular formula C11H15Cl2Si
and a molecular weight of 246.23 g/mol.
Molecular Properties
| Compound Name | CID 22401841 |
| PubChem CID | 22401841 |
| Molecular Formula | C11H15Cl2Si |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | — |
| SMILES | Cc1ccc(C(C)C[Si](Cl)Cl)cc1C |
| InChI | InChI=1S/C11H15Cl2Si/c1-8-4-5-11(6-9(8)2)10(3)7-14(12)13/h4-6,10H,7H2,1-3H3 |
| InChIKey | MRHDRPMUXSFZSW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze CID 22401841 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22401841?
The IUPAC name of CID 22401841 (CID 22401841) is not available.
What is the SMILES notation for CID 22401841?
The canonical SMILES for CID 22401841 is Cc1ccc(C(C)C[Si](Cl)Cl)cc1C.
What is the InChIKey of CID 22401841?
The InChIKey is MRHDRPMUXSFZSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15Cl2Si/c1-8-4-5-11(6-9(8)2)10(3)7-14(12)13/h4-6,10H,7H2,1-3H3.
What are the key properties of CID 22401841?
CID 22401841 has a molecular weight of 246.23 g/mol, XLogP of 4.37, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22401841 is sourced from PubChem (CID 22401841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).