C26H30F3N5O2S — CID 153334693
5-[1-(4-acetamidophenyl)sulfanylpiperidin-4-yl]-N,N-diethyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 153334693) has the molecular formula C26H30F3N5O2S and a molecular weight of 533.62 g/mol. Its IUPAC name is 5-[1-(4-acetamidophenyl)sulfanylpiperidin-4-yl]-N,N-diethyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | 5-[1-(4-acetamidophenyl)sulfanylpiperidin-4-yl]-N,N-diethyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 153334693 |
| Molecular Formula | C26H30F3N5O2S |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | 5-[1-(4-acetamidophenyl)sulfanylpiperidin-4-yl]-N,N-diethyl-2-(trifluoromethyl)pyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1c(C(F)(F)F)nn2ccc(C3CCN(Sc4ccc(NC(C)=O)cc4)CC3)cc12 |
| InChI | InChI=1S/C26H30F3N5O2S/c1-4-32(5-2)25(36)23-22-16-19(12-15-34(22)31-24(23)26(27,28)29)18-10-13-33(14-11-18)37-21-8-6-20(7-9-21)30-17(3)35/h6-9,12,15-16,18H,4-5,10-11,13-14H2,1-3H3,(H,30,35) |
| InChIKey | SPHZBKYIPLSVIJ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 69.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|