C28H40N6O2S — CID 153335453
4-[3-(3,3-dimethylbutyl)-2-oxopyrrolidin-1-yl]-20,20-dimethyl-10-thia-1,3,9,14,22-pentazatetracyclo[16.2.1.111,14.02,7]docosa-2(7),3,5,11(22),12-pentaen-8-one (PubChem CID 153335453) has the molecular formula C28H40N6O2S and a molecular weight of 524.74 g/mol. Its IUPAC name is 4-[3-(3,3-dimethylbutyl)-2-oxopyrrolidin-1-yl]-20,20-dimethyl-10-thia-1,3,9,14,22-pentazatetracyclo[16.2.1.111,14.02,7]docosa-2(7),3,5,11(22),12-pentaen-8-one.
| Compound Name | 4-[3-(3,3-dimethylbutyl)-2-oxopyrrolidin-1-yl]-20,20-dimethyl-10-thia-1,3,9,14,22-pentazatetracyclo[16.2.1.111,14.02,7]docosa-2(7),3,5,11(22),12-pentaen-8-one |
|---|---|
| PubChem CID | 153335453 |
| Molecular Formula | C28H40N6O2S |
| Molecular Weight | 524.74 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | 4-[3-(3,3-dimethylbutyl)-2-oxopyrrolidin-1-yl]-20,20-dimethyl-10-thia-1,3,9,14,22-pentazatetracyclo[16.2.1.111,14.02,7]docosa-2(7),3,5,11(22),12-pentaen-8-one |
| SMILES | CC(C)(C)CCC1CCN(c2ccc3c(n2)N2CC(CCCn4ccc(n4)SNC3=O)CC2(C)C)C1=O |
| InChI | InChI=1S/C28H40N6O2S/c1-27(2,3)13-10-20-11-16-33(26(20)36)22-9-8-21-24(29-22)34-18-19(17-28(34,4)5)7-6-14-32-15-12-23(30-32)37-31-25(21)35/h8-9,12,15,19-20H,6-7,10-11,13-14,16-18H2,1-5H3,(H,31,35) |
| InChIKey | QOFIXPCHUBBEIH-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.74 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|