C32H41F2N7O2S — CID 167248340
8-[3-[2-[1-(1,1-difluoroethyl)cyclopropyl]ethoxy]pyrazol-1-yl]-12,12-dimethyl-2-thia-3,9,11,20,25-pentazatetracyclo[19.3.1.111,14.05,10]hexacosa-1(24),5(10),6,8,21(25),22-hexaen-4-one (PubChem CID 167248340) has the molecular formula C32H41F2N7O2S and a molecular weight of 625.79 g/mol. Its IUPAC name is 8-[3-[2-[1-(1,1-difluoroethyl)cyclopropyl]ethoxy]pyrazol-1-yl]-12,12-dimethyl-2-thia-3,9,11,20,25-pentazatetracyclo[19.3.1.111,14.05,10]hexacosa-1(24),5(10),6,8,21(25),22-hexaen-4-one.
| Compound Name | 8-[3-[2-[1-(1,1-difluoroethyl)cyclopropyl]ethoxy]pyrazol-1-yl]-12,12-dimethyl-2-thia-3,9,11,20,25-pentazatetracyclo[19.3.1.111,14.05,10]hexacosa-1(24),5(10),6,8,21(25),22-hexaen-4-one |
|---|---|
| PubChem CID | 167248340 |
| Molecular Formula | C32H41F2N7O2S |
| Molecular Weight | 625.79 g/mol |
| Exact Mass | 625.30 |
| IUPAC Name | 8-[3-[2-[1-(1,1-difluoroethyl)cyclopropyl]ethoxy]pyrazol-1-yl]-12,12-dimethyl-2-thia-3,9,11,20,25-pentazatetracyclo[19.3.1.111,14.05,10]hexacosa-1(24),5(10),6,8,21(25),22-hexaen-4-one |
| SMILES | CC1(C)CC2CCCCCNc3cccc(n3)SNC(=O)c3ccc(-n4ccc(OCCC5(C(C)(F)F)CC5)n4)nc3N1C2 |
| InChI | InChI=1S/C32H41F2N7O2S/c1-30(2)20-22-8-5-4-6-17-35-24-9-7-10-27(36-24)44-39-29(42)23-11-12-25(37-28(23)40(30)21-22)41-18-13-26(38-41)43-19-16-32(14-15-32)31(3,33)34/h7,9-13,18,22H,4-6,8,14-17,19-21H2,1-3H3,(H,35,36)(H,39,42) |
| InChIKey | OZPNRPKHELAXQE-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.79 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|