C28H36F3N7O2S — CID 174071172
11-(aminomethylidene)-20,20-dimethyl-4-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]-10-thia-1,3,9,13-tetrazatricyclo[16.2.1.02,7]henicosa-2(7),3,5,12-tetraen-8-one (PubChem CID 174071172) has the molecular formula C28H36F3N7O2S and a molecular weight of 591.70 g/mol. Its IUPAC name is 11-(aminomethylidene)-20,20-dimethyl-4-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]-10-thia-1,3,9,13-tetrazatricyclo[16.2.1.02,7]henicosa-2(7),3,5,12-tetraen-8-one.
| Compound Name | 11-(aminomethylidene)-20,20-dimethyl-4-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]-10-thia-1,3,9,13-tetrazatricyclo[16.2.1.02,7]henicosa-2(7),3,5,12-tetraen-8-one |
|---|---|
| PubChem CID | 174071172 |
| Molecular Formula | C28H36F3N7O2S |
| Molecular Weight | 591.70 g/mol |
| Exact Mass | 591.26 |
| IUPAC Name | 11-(aminomethylidene)-20,20-dimethyl-4-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]-10-thia-1,3,9,13-tetrazatricyclo[16.2.1.02,7]henicosa-2(7),3,5,12-tetraen-8-one |
| SMILES | CC1(C)CC2CCCC/N=C\C(=CN)SNC(=O)c3ccc(-n4ccc(OCCC5(C(F)(F)F)CC5)n4)nc3N1C2 |
| InChI | InChI=1S/C28H36F3N7O2S/c1-26(2)15-19-5-3-4-12-33-17-20(16-32)41-36-25(39)21-6-7-22(34-24(21)37(26)18-19)38-13-8-23(35-38)40-14-11-27(9-10-27)28(29,30)31/h6-8,13,16-17,19H,3-5,9-12,14-15,18,32H2,1-2H3,(H,36,39)/b20-16?,33-17- |
| InChIKey | IREVLFXIUKOAFI-UMRXWRIZSA-N |
| XLogP | 5.42 |
| TPSA | 110.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.70 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|