C28H34F3N7O2S — CID 153335676
(11E)-11-ethenyl-20,20-dimethyl-13-methylidene-4-[3-[[1-(trifluoromethyl)cyclopropyl]methoxy]pyrazol-1-yl]-10-thia-1,3,9,12,14-pentazatricyclo[16.2.1.02,7]henicosa-2(7),3,5,11-tetraen-8-one (PubChem CID 153335676) has the molecular formula C28H34F3N7O2S and a molecular weight of 589.69 g/mol. Its IUPAC name is (11E)-11-ethenyl-20,20-dimethyl-13-methylidene-4-[3-[[1-(trifluoromethyl)cyclopropyl]methoxy]pyrazol-1-yl]-10-thia-1,3,9,12,14-pentazatricyclo[16.2.1.02,7]henicosa-2(7),3,5,11-tetraen-8-one.
| Compound Name | (11E)-11-ethenyl-20,20-dimethyl-13-methylidene-4-[3-[[1-(trifluoromethyl)cyclopropyl]methoxy]pyrazol-1-yl]-10-thia-1,3,9,12,14-pentazatricyclo[16.2.1.02,7]henicosa-2(7),3,5,11-tetraen-8-one |
|---|---|
| PubChem CID | 153335676 |
| Molecular Formula | C28H34F3N7O2S |
| Molecular Weight | 589.69 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | (11E)-11-ethenyl-20,20-dimethyl-13-methylidene-4-[3-[[1-(trifluoromethyl)cyclopropyl]methoxy]pyrazol-1-yl]-10-thia-1,3,9,12,14-pentazatricyclo[16.2.1.02,7]henicosa-2(7),3,5,11-tetraen-8-one |
| SMILES | C=C/C1=N\C(=C)NCCCC2CN(c3nc(-n4ccc(OCC5(C(F)(F)F)CC5)n4)ccc3C(=O)NS1)C(C)(C)C2 |
| InChI | InChI=1S/C28H34F3N7O2S/c1-5-23-33-18(2)32-13-6-7-19-15-26(3,4)37(16-19)24-20(25(39)36-41-23)8-9-21(34-24)38-14-10-22(35-38)40-17-27(11-12-27)28(29,30)31/h5,8-10,14,19,32H,1-2,6-7,11-13,15-17H2,3-4H3,(H,36,39)/b33-23+ |
| InChIKey | HIKCSIAWUCJBQV-GZZLJNBRSA-N |
| XLogP | 5.41 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.69 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|