C30H37F3N6O2S — CID 153336014
11-ethenyl-20,20-dimethyl-13-methylidene-4-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]-10-thia-1,3,9,12-tetrazatricyclo[16.2.1.02,7]henicosa-2(7),3,5,11-tetraen-8-one (PubChem CID 153336014) has the molecular formula C30H37F3N6O2S and a molecular weight of 602.73 g/mol. Its IUPAC name is 11-ethenyl-20,20-dimethyl-13-methylidene-4-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]-10-thia-1,3,9,12-tetrazatricyclo[16.2.1.02,7]henicosa-2(7),3,5,11-tetraen-8-one.
| Compound Name | 11-ethenyl-20,20-dimethyl-13-methylidene-4-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]-10-thia-1,3,9,12-tetrazatricyclo[16.2.1.02,7]henicosa-2(7),3,5,11-tetraen-8-one |
|---|---|
| PubChem CID | 153336014 |
| Molecular Formula | C30H37F3N6O2S |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | 11-ethenyl-20,20-dimethyl-13-methylidene-4-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]-10-thia-1,3,9,12-tetrazatricyclo[16.2.1.02,7]henicosa-2(7),3,5,11-tetraen-8-one |
| SMILES | C=C/C1=N\C(=C)CCCCC2CN(c3nc(-n4ccc(OCCC5(C(F)(F)F)CC5)n4)ccc3C(=O)NS1)C(C)(C)C2 |
| InChI | InChI=1S/C30H37F3N6O2S/c1-5-25-34-20(2)8-6-7-9-21-18-28(3,4)38(19-21)26-22(27(40)37-42-25)10-11-23(35-26)39-16-12-24(36-39)41-17-15-29(13-14-29)30(31,32)33/h5,10-12,16,21H,1-2,6-9,13-15,17-19H2,3-4H3,(H,37,40)/b34-25+ |
| InChIKey | BMJOGZYKSNVTAZ-YQCHCMBFSA-N |
| XLogP | 7.03 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|