C29H39N5OS — CID 156639642
4-tert-butyl-15-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-20,20-dimethyl-10-thia-1,3,9,14,22-pentazatetracyclo[16.2.1.111,14.02,7]docosa-2(7),3,5,11(22),12-pentaen-8-one (PubChem CID 156639642) has the molecular formula C29H39N5OS and a molecular weight of 505.73 g/mol. Its IUPAC name is 4-tert-butyl-15-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-20,20-dimethyl-10-thia-1,3,9,14,22-pentazatetracyclo[16.2.1.111,14.02,7]docosa-2(7),3,5,11(22),12-pentaen-8-one.
| Compound Name | 4-tert-butyl-15-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-20,20-dimethyl-10-thia-1,3,9,14,22-pentazatetracyclo[16.2.1.111,14.02,7]docosa-2(7),3,5,11(22),12-pentaen-8-one |
|---|---|
| PubChem CID | 156639642 |
| Molecular Formula | C29H39N5OS |
| Molecular Weight | 505.73 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | 4-tert-butyl-15-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-20,20-dimethyl-10-thia-1,3,9,14,22-pentazatetracyclo[16.2.1.111,14.02,7]docosa-2(7),3,5,11(22),12-pentaen-8-one |
| SMILES | C=C/C=C(\C=C/C)C1CCC2CN(c3nc(C(C)(C)C)ccc3C(=O)NSc3ccn1n3)C(C)(C)C2 |
| InChI | InChI=1S/C29H39N5OS/c1-8-10-21(11-9-2)23-14-12-20-18-29(6,7)33(19-20)26-22(13-15-24(30-26)28(3,4)5)27(35)32-36-25-16-17-34(23)31-25/h8-11,13,15-17,20,23H,1,12,14,18-19H2,2-7H3,(H,32,35)/b11-9-,21-10+ |
| InChIKey | STWFFXUDNGMRQO-LONVQWMRSA-N |
| XLogP | 6.64 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.73 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|