C36H47N7O3S — CID 156638903
methyl 4-[2-(8-tert-butyl-12,12-dimethyl-4-oxo-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-17-yl)-4-pyridinyl]piperidine-1-carboxylate (PubChem CID 156638903) has the molecular formula C36H47N7O3S and a molecular weight of 657.89 g/mol. Its IUPAC name is methyl 4-[2-(8-tert-butyl-12,12-dimethyl-4-oxo-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-17-yl)-4-pyridinyl]piperidine-1-carboxylate.
| Compound Name | methyl 4-[2-(8-tert-butyl-12,12-dimethyl-4-oxo-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-17-yl)-4-pyridinyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 156638903 |
| Molecular Formula | C36H47N7O3S |
| Molecular Weight | 657.89 g/mol |
| Exact Mass | 657.35 |
| IUPAC Name | methyl 4-[2-(8-tert-butyl-12,12-dimethyl-4-oxo-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-17-yl)-4-pyridinyl]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(c2ccnc(C3CCC4CN(c5nc(C(C)(C)C)ccc5C(=O)NSc5cccc(n5)N3)C(C)(C)C4)c2)CC1 |
| InChI | InChI=1S/C36H47N7O3S/c1-35(2,3)29-13-11-26-32(39-29)43-22-23(21-36(43,4)5)10-12-27(38-30-8-7-9-31(40-30)47-41-33(26)44)28-20-25(14-17-37-28)24-15-18-42(19-16-24)34(45)46-6/h7-9,11,13-14,17,20,23-24,27H,10,12,15-16,18-19,21-22H2,1-6H3,(H,38,40)(H,41,44) |
| InChIKey | QOOYRICKCOUMHO-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 112.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.89 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|