C34H44BrN5OS — CID 156639301
7-bromo-8-tert-butyl-17-(4-tert-butyl-2-pyridinyl)-12,12-dimethyl-2-thia-3,11,18,23-tetrazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5,7,9,19(23),20-hexaen-4-one (PubChem CID 156639301) has the molecular formula C34H44BrN5OS and a molecular weight of 650.73 g/mol. Its IUPAC name is 7-bromo-8-tert-butyl-17-(4-tert-butyl-2-pyridinyl)-12,12-dimethyl-2-thia-3,11,18,23-tetrazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5,7,9,19(23),20-hexaen-4-one.
| Compound Name | 7-bromo-8-tert-butyl-17-(4-tert-butyl-2-pyridinyl)-12,12-dimethyl-2-thia-3,11,18,23-tetrazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5,7,9,19(23),20-hexaen-4-one |
|---|---|
| PubChem CID | 156639301 |
| Molecular Formula | C34H44BrN5OS |
| Molecular Weight | 650.73 g/mol |
| Exact Mass | 649.24 |
| IUPAC Name | 7-bromo-8-tert-butyl-17-(4-tert-butyl-2-pyridinyl)-12,12-dimethyl-2-thia-3,11,18,23-tetrazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5,7,9,19(23),20-hexaen-4-one |
| SMILES | CC(C)(C)c1ccnc(C2CCC3CN(c4cc(C(C)(C)C)c(Br)cc4C(=O)NSc4cccc(n4)N2)C(C)(C)C3)c1 |
| InChI | InChI=1S/C34H44BrN5OS/c1-32(2,3)22-14-15-36-27(16-22)26-13-12-21-19-34(7,8)40(20-21)28-18-24(33(4,5)6)25(35)17-23(28)31(41)39-42-30-11-9-10-29(37-26)38-30/h9-11,14-18,21,26H,12-13,19-20H2,1-8H3,(H,37,38)(H,39,41) |
| InChIKey | NXOYAMYZHSKEIW-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.73 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|