C26H29N5OS — CID 156639251
12,12-dimethyl-17-phenyl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one (PubChem CID 156639251) has the molecular formula C26H29N5OS and a molecular weight of 459.62 g/mol. Its IUPAC name is 12,12-dimethyl-17-phenyl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one.
| Compound Name | 12,12-dimethyl-17-phenyl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one |
|---|---|
| PubChem CID | 156639251 |
| Molecular Formula | C26H29N5OS |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 12,12-dimethyl-17-phenyl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one |
| SMILES | CC1(C)CC2CCC(c3ccccc3)Nc3cccc(n3)SNC(=O)c3cccnc3N1C2 |
| InChI | InChI=1S/C26H29N5OS/c1-26(2)16-18-13-14-21(19-8-4-3-5-9-19)28-22-11-6-12-23(29-22)33-30-25(32)20-10-7-15-27-24(20)31(26)17-18/h3-12,15,18,21H,13-14,16-17H2,1-2H3,(H,28,29)(H,30,32) |
| InChIKey | LSICUGWVXBZIRV-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|