C31H37N7OS — CID 156639170
6-(8-tert-butyl-12,12,15-trimethyl-4-oxo-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-17-yl)pyridine-2-carbonitrile (PubChem CID 156639170) has the molecular formula C31H37N7OS and a molecular weight of 555.75 g/mol. Its IUPAC name is 6-(8-tert-butyl-12,12,15-trimethyl-4-oxo-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-17-yl)pyridine-2-carbonitrile.
| Compound Name | 6-(8-tert-butyl-12,12,15-trimethyl-4-oxo-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-17-yl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 156639170 |
| Molecular Formula | C31H37N7OS |
| Molecular Weight | 555.75 g/mol |
| Exact Mass | 555.28 |
| IUPAC Name | 6-(8-tert-butyl-12,12,15-trimethyl-4-oxo-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-17-yl)pyridine-2-carbonitrile |
| SMILES | CC1CC(c2cccc(C#N)n2)Nc2cccc(n2)SNC(=O)c2ccc(C(C)(C)C)nc2N2CC1CC2(C)C |
| InChI | InChI=1S/C31H37N7OS/c1-19-15-24(23-10-7-9-21(17-32)33-23)34-26-11-8-12-27(36-26)40-37-29(39)22-13-14-25(30(2,3)4)35-28(22)38-18-20(19)16-31(38,5)6/h7-14,19-20,24H,15-16,18H2,1-6H3,(H,34,36)(H,37,39) |
| InChIKey | JSVUQKFWSMYNPS-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.75 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|