C31H39BrN6OS — CID 156638957
17-[(5-bromo-2-pyridinyl)methyl]-8-tert-butyl-12,12,15-trimethyl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one (PubChem CID 156638957) has the molecular formula C31H39BrN6OS and a molecular weight of 623.67 g/mol. Its IUPAC name is 17-[(5-bromo-2-pyridinyl)methyl]-8-tert-butyl-12,12,15-trimethyl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one.
| Compound Name | 17-[(5-bromo-2-pyridinyl)methyl]-8-tert-butyl-12,12,15-trimethyl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one |
|---|---|
| PubChem CID | 156638957 |
| Molecular Formula | C31H39BrN6OS |
| Molecular Weight | 623.67 g/mol |
| Exact Mass | 622.21 |
| IUPAC Name | 17-[(5-bromo-2-pyridinyl)methyl]-8-tert-butyl-12,12,15-trimethyl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one |
| SMILES | CC1CC(Cc2ccc(Br)cn2)Nc2cccc(n2)SNC(=O)c2ccc(C(C)(C)C)nc2N2CC1CC2(C)C |
| InChI | InChI=1S/C31H39BrN6OS/c1-19-14-23(15-22-11-10-21(32)17-33-22)34-26-8-7-9-27(36-26)40-37-29(39)24-12-13-25(30(2,3)4)35-28(24)38-18-20(19)16-31(38,5)6/h7-13,17,19-20,23H,14-16,18H2,1-6H3,(H,34,36)(H,37,39) |
| InChIKey | MVVTUKZETDFFFC-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.67 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|