C27H37N5O3S — CID 156639650
methyl 8-tert-butyl-12,12,15-trimethyl-4-oxo-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaene-17-carboxylate (PubChem CID 156639650) has the molecular formula C27H37N5O3S and a molecular weight of 511.69 g/mol. Its IUPAC name is methyl 8-tert-butyl-12,12,15-trimethyl-4-oxo-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaene-17-carboxylate.
| Compound Name | methyl 8-tert-butyl-12,12,15-trimethyl-4-oxo-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaene-17-carboxylate |
|---|---|
| PubChem CID | 156639650 |
| Molecular Formula | C27H37N5O3S |
| Molecular Weight | 511.69 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | methyl 8-tert-butyl-12,12,15-trimethyl-4-oxo-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaene-17-carboxylate |
| SMILES | COC(=O)C1CC(C)C2CN(c3nc(C(C)(C)C)ccc3C(=O)NSc3cccc(n3)N1)C(C)(C)C2 |
| InChI | InChI=1S/C27H37N5O3S/c1-16-13-19(25(34)35-7)28-21-9-8-10-22(30-21)36-31-24(33)18-11-12-20(26(2,3)4)29-23(18)32-15-17(16)14-27(32,5)6/h8-12,16-17,19H,13-15H2,1-7H3,(H,28,30)(H,31,33) |
| InChIKey | DALGGLXHUCSYCU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.69 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|