C30H47N5OS — CID 156639179
8-tert-butyl-17-ethenyl-12,12-dimethyl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one;ethane (PubChem CID 156639179) has the molecular formula C30H47N5OS and a molecular weight of 525.81 g/mol. Its IUPAC name is 8-tert-butyl-17-ethenyl-12,12-dimethyl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one;ethane.
| Compound Name | 8-tert-butyl-17-ethenyl-12,12-dimethyl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one;ethane |
|---|---|
| PubChem CID | 156639179 |
| Molecular Formula | C30H47N5OS |
| Molecular Weight | 525.81 g/mol |
| Exact Mass | 525.35 |
| IUPAC Name | 8-tert-butyl-17-ethenyl-12,12-dimethyl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one;ethane |
| SMILES | C=CC1CCC2CN(c3nc(C(C)(C)C)ccc3C(=O)NSc3cccc(n3)N1)C(C)(C)C2.CC.CC |
| InChI | InChI=1S/C26H35N5OS.2C2H6/c1-7-18-12-11-17-15-26(5,6)31(16-17)23-19(13-14-20(28-23)25(2,3)4)24(32)30-33-22-10-8-9-21(27-18)29-22;2*1-2/h7-10,13-14,17-18H,1,11-12,15-16H2,2-6H3,(H,27,29)(H,30,32);2*1-2H3 |
| InChIKey | GFZQRVRWTBHBIK-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.81 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|