C26H37N5O2S — CID 156639110
2-[(11E)-4-tert-butyl-11-ethenyl-20,20-dimethyl-13-methylidene-8-oxo-10-thia-1,3,9,12,14-pentazatricyclo[16.2.1.02,7]henicosa-2(7),3,5,11-tetraen-15-yl]acetaldehyde (PubChem CID 156639110) has the molecular formula C26H37N5O2S and a molecular weight of 483.68 g/mol. Its IUPAC name is 2-[(11E)-4-tert-butyl-11-ethenyl-20,20-dimethyl-13-methylidene-8-oxo-10-thia-1,3,9,12,14-pentazatricyclo[16.2.1.02,7]henicosa-2(7),3,5,11-tetraen-15-yl]acetaldehyde.
| Compound Name | 2-[(11E)-4-tert-butyl-11-ethenyl-20,20-dimethyl-13-methylidene-8-oxo-10-thia-1,3,9,12,14-pentazatricyclo[16.2.1.02,7]henicosa-2(7),3,5,11-tetraen-15-yl]acetaldehyde |
|---|---|
| PubChem CID | 156639110 |
| Molecular Formula | C26H37N5O2S |
| Molecular Weight | 483.68 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | 2-[(11E)-4-tert-butyl-11-ethenyl-20,20-dimethyl-13-methylidene-8-oxo-10-thia-1,3,9,12,14-pentazatricyclo[16.2.1.02,7]henicosa-2(7),3,5,11-tetraen-15-yl]acetaldehyde |
| SMILES | C=C/C1=N\C(=C)NC(CC=O)CCC2CN(c3nc(C(C)(C)C)ccc3C(=O)NS1)C(C)(C)C2 |
| InChI | InChI=1S/C26H37N5O2S/c1-8-22-28-17(2)27-19(13-14-32)10-9-18-15-26(6,7)31(16-18)23-20(24(33)30-34-22)11-12-21(29-23)25(3,4)5/h8,11-12,14,18-19,27H,1-2,9-10,13,15-16H2,3-7H3,(H,30,33)/b28-22+ |
| InChIKey | QIWBYHSWGYRSFI-XAYXJRQQSA-N |
| XLogP | 4.76 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.68 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|