C25H35N5OS — CID 156639515
8-tert-butyl-12,12,17-trimethyl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one (PubChem CID 156639515) has the molecular formula C25H35N5OS and a molecular weight of 453.66 g/mol. Its IUPAC name is 8-tert-butyl-12,12,17-trimethyl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one.
| Compound Name | 8-tert-butyl-12,12,17-trimethyl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one |
|---|---|
| PubChem CID | 156639515 |
| Molecular Formula | C25H35N5OS |
| Molecular Weight | 453.66 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | 8-tert-butyl-12,12,17-trimethyl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one |
| SMILES | CC1CCC2CN(c3nc(C(C)(C)C)ccc3C(=O)NSc3cccc(n3)N1)C(C)(C)C2 |
| InChI | InChI=1S/C25H35N5OS/c1-16-10-11-17-14-25(5,6)30(15-17)22-18(12-13-19(27-22)24(2,3)4)23(31)29-32-21-9-7-8-20(26-16)28-21/h7-9,12-13,16-17H,10-11,14-15H2,1-6H3,(H,26,28)(H,29,31) |
| InChIKey | JKXCGRPTQFQBBY-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.66 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|