C27H35N5OS — CID 163774273
(7S)-13-tert-butyl-3-ethenyl-9,9-dimethyl-19-thia-2,10,12,18,24-pentazapentacyclo[18.3.1.17,10.05,7.011,16]pentacosa-1(24),11(16),12,14,20,22-hexaen-17-one (PubChem CID 163774273) has the molecular formula C27H35N5OS and a molecular weight of 477.68 g/mol. Its IUPAC name is (7S)-13-tert-butyl-3-ethenyl-9,9-dimethyl-19-thia-2,10,12,18,24-pentazapentacyclo[18.3.1.17,10.05,7.011,16]pentacosa-1(24),11(16),12,14,20,22-hexaen-17-one.
| Compound Name | (7S)-13-tert-butyl-3-ethenyl-9,9-dimethyl-19-thia-2,10,12,18,24-pentazapentacyclo[18.3.1.17,10.05,7.011,16]pentacosa-1(24),11(16),12,14,20,22-hexaen-17-one |
|---|---|
| PubChem CID | 163774273 |
| Molecular Formula | C27H35N5OS |
| Molecular Weight | 477.68 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | (7S)-13-tert-butyl-3-ethenyl-9,9-dimethyl-19-thia-2,10,12,18,24-pentazapentacyclo[18.3.1.17,10.05,7.011,16]pentacosa-1(24),11(16),12,14,20,22-hexaen-17-one |
| SMILES | C=CC1CC2C[C@@]23CN(c2nc(C(C)(C)C)ccc2C(=O)NSc2cccc(n2)N1)C(C)(C)C3 |
| InChI | InChI=1S/C27H35N5OS/c1-7-18-13-17-14-27(17)15-26(5,6)32(16-27)23-19(11-12-20(29-23)25(2,3)4)24(33)31-34-22-10-8-9-21(28-18)30-22/h7-12,17-18H,1,13-16H2,2-6H3,(H,28,30)(H,31,33)/t17?,18?,27-/m1/s1 |
| InChIKey | MJBHYEKZFHEERR-DIAWHCHDSA-N |
| XLogP | 5.58 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.68 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|