C25H31N5O2S — CID 153335884
8-(3,4-dihydro-2H-pyran-6-yl)-12,12-dimethyl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one (PubChem CID 153335884) has the molecular formula C25H31N5O2S and a molecular weight of 465.62 g/mol. Its IUPAC name is 8-(3,4-dihydro-2H-pyran-6-yl)-12,12-dimethyl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one.
| Compound Name | 8-(3,4-dihydro-2H-pyran-6-yl)-12,12-dimethyl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one |
|---|---|
| PubChem CID | 153335884 |
| Molecular Formula | C25H31N5O2S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 8-(3,4-dihydro-2H-pyran-6-yl)-12,12-dimethyl-2-thia-3,9,11,18,23-pentazatetracyclo[17.3.1.111,14.05,10]tetracosa-1(22),5(10),6,8,19(23),20-hexaen-4-one |
| SMILES | CC1(C)CC2CCCNc3cccc(n3)SNC(=O)c3ccc(C4=CCCCO4)nc3N1C2 |
| InChI | InChI=1S/C25H31N5O2S/c1-25(2)15-17-7-6-13-26-21-9-5-10-22(28-21)33-29-24(31)18-11-12-19(20-8-3-4-14-32-20)27-23(18)30(25)16-17/h5,8-12,17H,3-4,6-7,13-16H2,1-2H3,(H,26,28)(H,29,31) |
| InChIKey | AQHJVCSQZUHQKX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|