C11H12BrN3O2 — CID 153336540
(1S,4S)-2-(5-bromo-2-nitrophenyl)-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 153336540) has the molecular formula C11H12BrN3O2 and a molecular weight of 298.14 g/mol. Its IUPAC name is (1S,4S)-2-(5-bromo-2-nitrophenyl)-2,5-diazabicyclo[2.2.1]heptane.
| Compound Name | (1S,4S)-2-(5-bromo-2-nitrophenyl)-2,5-diazabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 153336540 |
| Molecular Formula | C11H12BrN3O2 |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | (1S,4S)-2-(5-bromo-2-nitrophenyl)-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | O=[N+]([O-])c1ccc(Br)cc1N1C[C@@H]2C[C@H]1CN2 |
| InChI | InChI=1S/C11H12BrN3O2/c12-7-1-2-10(15(16)17)11(3-7)14-6-8-4-9(14)5-13-8/h1-3,8-9,13H,4-6H2/t8-,9-/m0/s1 |
| InChIKey | SOBPFSVTVMAXCW-IUCAKERBSA-N |
| XLogP | 1.91 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|