C17H23N5O4 — CID 67115047
5-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-nitro-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide (PubChem CID 67115047) has the molecular formula C17H23N5O4 and a molecular weight of 361.40 g/mol. Its IUPAC name is 5-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-nitro-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide.
| Compound Name | 5-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-nitro-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 67115047 |
| Molecular Formula | C17H23N5O4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 5-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2-nitro-N-[2-oxo-2-(propan-2-ylamino)ethyl]benzamide |
| SMILES | CC(C)NC(=O)CNC(=O)c1cc(N2C[C@@H]3C[C@H]2CN3)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H23N5O4/c1-10(2)20-16(23)8-19-17(24)14-6-12(3-4-15(14)22(25)26)21-9-11-5-13(21)7-18-11/h3-4,6,10-11,13,18H,5,7-9H2,1-2H3,(H,19,24)(H,20,23)/t11-,13-/m0/s1 |
| InChIKey | ZEYQWJUCBCBJGJ-AAEUAGOBSA-N |
| XLogP | 0.40 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|