C20H40N2O5 — CID 153336650
N-[2-[2-[2-[2-(3-ethyliminopropoxy)ethoxy]ethoxy]ethoxy]ethyl]heptanamide (PubChem CID 153336650) has the molecular formula C20H40N2O5 and a molecular weight of 388.55 g/mol. Its IUPAC name is N-[2-[2-[2-[2-(3-ethyliminopropoxy)ethoxy]ethoxy]ethoxy]ethyl]heptanamide.
| Compound Name | N-[2-[2-[2-[2-(3-ethyliminopropoxy)ethoxy]ethoxy]ethoxy]ethyl]heptanamide |
|---|---|
| PubChem CID | 153336650 |
| Molecular Formula | C20H40N2O5 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.29 |
| IUPAC Name | N-[2-[2-[2-[2-(3-ethyliminopropoxy)ethoxy]ethoxy]ethoxy]ethyl]heptanamide |
| SMILES | CCCCCCC(=O)NCCOCCOCCOCCOCC/C=N/CC |
| InChI | InChI=1S/C20H40N2O5/c1-3-5-6-7-9-20(23)22-11-13-25-15-17-27-19-18-26-16-14-24-12-8-10-21-4-2/h10H,3-9,11-19H2,1-2H3,(H,22,23)/b21-10+ |
| InChIKey | VTPSIXJDPYNVHI-UFFVCSGVSA-N |
| XLogP | 2.62 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|