C32H48N4O3 — CID 153336861
tert-butyl 5-[3-[(3-tert-butylbenzoyl)amino]phenyl]pyrazole-1-carboxylate;ethane;N-ethylpropan-1-amine (PubChem CID 153336861) has the molecular formula C32H48N4O3 and a molecular weight of 536.76 g/mol. Its IUPAC name is tert-butyl 5-[3-[(3-tert-butylbenzoyl)amino]phenyl]pyrazole-1-carboxylate;ethane;N-ethylpropan-1-amine.
| Compound Name | tert-butyl 5-[3-[(3-tert-butylbenzoyl)amino]phenyl]pyrazole-1-carboxylate;ethane;N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 153336861 |
| Molecular Formula | C32H48N4O3 |
| Molecular Weight | 536.76 g/mol |
| Exact Mass | 536.37 |
| IUPAC Name | tert-butyl 5-[3-[(3-tert-butylbenzoyl)amino]phenyl]pyrazole-1-carboxylate;ethane;N-ethylpropan-1-amine |
| SMILES | CC.CC(C)(C)OC(=O)n1nccc1-c1cccc(NC(=O)c2cccc(C(C)(C)C)c2)c1.CCCNCC |
| InChI | InChI=1S/C25H29N3O3.C5H13N.C2H6/c1-24(2,3)19-11-7-10-18(15-19)22(29)27-20-12-8-9-17(16-20)21-13-14-26-28(21)23(30)31-25(4,5)6;1-3-5-6-4-2;1-2/h7-16H,1-6H3,(H,27,29);6H,3-5H2,1-2H3;1-2H3 |
| InChIKey | QSZCUHHHLXCSQN-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.76 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|