C23H23N3O5 — CID 153336868
tert-butyl 5-[3-[(3-acetyloxybenzoyl)amino]phenyl]pyrazole-1-carboxylate (PubChem CID 153336868) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is tert-butyl 5-[3-[(3-acetyloxybenzoyl)amino]phenyl]pyrazole-1-carboxylate.
| Compound Name | tert-butyl 5-[3-[(3-acetyloxybenzoyl)amino]phenyl]pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 153336868 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | tert-butyl 5-[3-[(3-acetyloxybenzoyl)amino]phenyl]pyrazole-1-carboxylate |
| SMILES | CC(=O)Oc1cccc(C(=O)Nc2cccc(-c3ccnn3C(=O)OC(C)(C)C)c2)c1 |
| InChI | InChI=1S/C23H23N3O5/c1-15(27)30-19-10-6-8-17(14-19)21(28)25-18-9-5-7-16(13-18)20-11-12-24-26(20)22(29)31-23(2,3)4/h5-14H,1-4H3,(H,25,28) |
| InChIKey | NTJWVTQYIKAYNW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|