C28H28N4O4 — CID 139434985
tert-butyl 5-[3-[(3-phenylmethoxyphenyl)carbamoylamino]phenyl]pyrazole-1-carboxylate (PubChem CID 139434985) has the molecular formula C28H28N4O4 and a molecular weight of 484.56 g/mol. Its IUPAC name is tert-butyl 5-[3-[(3-phenylmethoxyphenyl)carbamoylamino]phenyl]pyrazole-1-carboxylate.
| Compound Name | tert-butyl 5-[3-[(3-phenylmethoxyphenyl)carbamoylamino]phenyl]pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 139434985 |
| Molecular Formula | C28H28N4O4 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | tert-butyl 5-[3-[(3-phenylmethoxyphenyl)carbamoylamino]phenyl]pyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nccc1-c1cccc(NC(=O)Nc2cccc(OCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C28H28N4O4/c1-28(2,3)36-27(34)32-25(15-16-29-32)21-11-7-12-22(17-21)30-26(33)31-23-13-8-14-24(18-23)35-19-20-9-5-4-6-10-20/h4-18H,19H2,1-3H3,(H2,30,31,33) |
| InChIKey | MXQKAHJRNVKIAK-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |