C23H29N7 — CID 153337112
N-[3-[2-amino-5-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]phenyl]buta-1,3-dien-2-yl]-1-methylpyrazol-4-amine (PubChem CID 153337112) has the molecular formula C23H29N7 and a molecular weight of 403.53 g/mol. Its IUPAC name is N-[3-[2-amino-5-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]phenyl]buta-1,3-dien-2-yl]-1-methylpyrazol-4-amine.
| Compound Name | N-[3-[2-amino-5-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]phenyl]buta-1,3-dien-2-yl]-1-methylpyrazol-4-amine |
|---|---|
| PubChem CID | 153337112 |
| Molecular Formula | C23H29N7 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | N-[3-[2-amino-5-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]phenyl]buta-1,3-dien-2-yl]-1-methylpyrazol-4-amine |
| SMILES | C=C(Nc1cnn(C)c1)C(=C)c1cc(-c2cnn(C3CCN(C)CC3)c2)ccc1N |
| InChI | InChI=1S/C23H29N7/c1-16(17(2)27-20-13-25-29(4)15-20)22-11-18(5-6-23(22)24)19-12-26-30(14-19)21-7-9-28(3)10-8-21/h5-6,11-15,21,27H,1-2,7-10,24H2,3-4H3 |
| InChIKey | HUPCXGLBJXPGKM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 76.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|