C9H18N2O6 — CID 153337415
2-[carboxymethyl-[2-(methoxyamino)-2-oxoethyl]amino]acetic acid;ethane (PubChem CID 153337415) has the molecular formula C9H18N2O6 and a molecular weight of 250.25 g/mol. Its IUPAC name is 2-[carboxymethyl-[2-(methoxyamino)-2-oxoethyl]amino]acetic acid;ethane.
| Compound Name | 2-[carboxymethyl-[2-(methoxyamino)-2-oxoethyl]amino]acetic acid;ethane |
|---|---|
| PubChem CID | 153337415 |
| Molecular Formula | C9H18N2O6 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-[carboxymethyl-[2-(methoxyamino)-2-oxoethyl]amino]acetic acid;ethane |
| SMILES | CC.CONC(=O)CN(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C7H12N2O6.C2H6/c1-15-8-5(10)2-9(3-6(11)12)4-7(13)14;1-2/h2-4H2,1H3,(H,8,10)(H,11,12)(H,13,14);1-2H3 |
| InChIKey | OUPSOWUUELCDLD-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|