C36H40BFN4O4 — CID 153339057
4-[[4-fluoro-3-[8-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,8-diazaspiro[4.5]decane-2-carbonyl]phenyl]methyl]-2H-phthalazin-1-one (PubChem CID 153339057) has the molecular formula C36H40BFN4O4 and a molecular weight of 622.55 g/mol. Its IUPAC name is 4-[[4-fluoro-3-[8-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,8-diazaspiro[4.5]decane-2-carbonyl]phenyl]methyl]-2H-phthalazin-1-one.
| Compound Name | 4-[[4-fluoro-3-[8-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,8-diazaspiro[4.5]decane-2-carbonyl]phenyl]methyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 153339057 |
| Molecular Formula | C36H40BFN4O4 |
| Molecular Weight | 622.55 g/mol |
| Exact Mass | 622.31 |
| IUPAC Name | 4-[[4-fluoro-3-[8-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2,8-diazaspiro[4.5]decane-2-carbonyl]phenyl]methyl]-2H-phthalazin-1-one |
| SMILES | CC1(C)OB(c2ccc(N3CCC4(CCN(C(=O)c5cc(Cc6n[nH]c(=O)c7ccccc67)ccc5F)C4)CC3)cc2)OC1(C)C |
| InChI | InChI=1S/C36H40BFN4O4/c1-34(2)35(3,4)46-37(45-34)25-10-12-26(13-11-25)41-18-15-36(16-19-41)17-20-42(23-36)33(44)29-21-24(9-14-30(29)38)22-31-27-7-5-6-8-28(27)32(43)40-39-31/h5-14,21H,15-20,22-23H2,1-4H3,(H,40,43) |
| InChIKey | UNDKNOQCDXAKOT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 87.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.55 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|