C36H39BFN3O4 — CID 148633688
4-[[4-fluoro-3-[7-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-azaspiro[3.5]nonane-2-carbonyl]phenyl]methyl]-2H-phthalazin-1-one (PubChem CID 148633688) has the molecular formula C36H39BFN3O4 and a molecular weight of 607.54 g/mol. Its IUPAC name is 4-[[4-fluoro-3-[7-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-azaspiro[3.5]nonane-2-carbonyl]phenyl]methyl]-2H-phthalazin-1-one.
| Compound Name | 4-[[4-fluoro-3-[7-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-azaspiro[3.5]nonane-2-carbonyl]phenyl]methyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 148633688 |
| Molecular Formula | C36H39BFN3O4 |
| Molecular Weight | 607.54 g/mol |
| Exact Mass | 607.30 |
| IUPAC Name | 4-[[4-fluoro-3-[7-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-azaspiro[3.5]nonane-2-carbonyl]phenyl]methyl]-2H-phthalazin-1-one |
| SMILES | CC1(C)OB(c2ccc(C3CCC4(CC3)CN(C(=O)c3cc(Cc5n[nH]c(=O)c6ccccc56)ccc3F)C4)cc2)OC1(C)C |
| InChI | InChI=1S/C36H39BFN3O4/c1-34(2)35(3,4)45-37(44-34)26-12-10-24(11-13-26)25-15-17-36(18-16-25)21-41(22-36)33(43)29-19-23(9-14-30(29)38)20-31-27-7-5-6-8-28(27)32(42)40-39-31/h5-14,19,25H,15-18,20-22H2,1-4H3,(H,40,42) |
| InChIKey | NIQGONWHBIHXMO-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.54 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|