C24H29FO2 — CID 153339431
4-[1-(3,4-ditert-butyl-2-fluoro-6-methylphenyl)ethenyl]benzoic acid (PubChem CID 153339431) has the molecular formula C24H29FO2 and a molecular weight of 368.49 g/mol. Its IUPAC name is 4-[1-(3,4-ditert-butyl-2-fluoro-6-methylphenyl)ethenyl]benzoic acid.
| Compound Name | 4-[1-(3,4-ditert-butyl-2-fluoro-6-methylphenyl)ethenyl]benzoic acid |
|---|---|
| PubChem CID | 153339431 |
| Molecular Formula | C24H29FO2 |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 4-[1-(3,4-ditert-butyl-2-fluoro-6-methylphenyl)ethenyl]benzoic acid |
| SMILES | C=C(c1ccc(C(=O)O)cc1)c1c(C)cc(C(C)(C)C)c(C(C)(C)C)c1F |
| InChI | InChI=1S/C24H29FO2/c1-14-13-18(23(3,4)5)20(24(6,7)8)21(25)19(14)15(2)16-9-11-17(12-10-16)22(26)27/h9-13H,2H2,1,3-8H3,(H,26,27) |
| InChIKey | NKRHJGXDZJJETH-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |