C23H20ClFO2 — CID 147460605
CID 147460605 (PubChem CID 147460605) has the molecular formula C23H20ClFO2 and a molecular weight of 382.86 g/mol.
| Compound Name | CID 147460605 |
|---|---|
| PubChem CID | 147460605 |
| Molecular Formula | C23H20ClFO2 |
| Molecular Weight | 382.86 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | — |
| SMILES | C=C(c1ccc(C(=O)O)cc1)c1c(Cl)cc2c(c1F)C1(CCC23CC3)CC1 |
| InChI | InChI=1S/C23H20ClFO2/c1-13(14-2-4-15(5-3-14)21(26)27)18-17(24)12-16-19(20(18)25)23(10-11-23)9-8-22(16)6-7-22/h2-5,12H,1,6-11H2,(H,26,27) |
| InChIKey | DZWBJQYBIBOYHW-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.86 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |