C74H72F4O6 — CID 153339440
CID 153339440 (PubChem CID 153339440) has the molecular formula C74H72F4O6 and a molecular weight of 1133.38 g/mol.
| Compound Name | CID 153339440 |
|---|---|
| PubChem CID | 153339440 |
| Molecular Formula | C74H72F4O6 |
| Molecular Weight | 1133.38 g/mol |
| Exact Mass | 1132.53 |
| IUPAC Name | — |
| SMILES | C=C(c1ccc(C(=O)O)cc1)c1cc2c(cc1C)C1(CCC2(C)C)CC1C1CC12CCC(C)(C)c1cc(C(F)C/C=C(\c3ccc(C(=O)O)cc3)c3c(C(C)F)cc4c(c3F)C3(CCC45CC5)CC3)c(C(=C)c3ccc(C(=O)O)cc3)c(F)c12 |
| InChI | InChI=1S/C74H72F4O6/c1-39-33-54-53(34-50(39)40(2)43-9-15-46(16-10-43)66(79)80)69(5,6)23-31-73(54)37-57(73)58-38-74(58)32-24-70(7,8)55-36-52(60(64(77)63(55)74)41(3)44-11-17-47(18-12-44)67(81)82)59(76)22-21-49(45-13-19-48(20-14-45)68(83)84)61-51(42(4)75)35-56-62(65(61)78)72(29-30-72)28-27-71(56)25-26-71/h9-21,33-36,42,57-59H,2-3,22-32,37-38H2,1,4-8H3,(H,79,80)(H,81,82)(H,83,84)/b49-21+ |
| InChIKey | RWQUCGMTCDSCOW-ZFMRUCPMSA-N |
| XLogP | 18.27 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1133.38 |
| LogP ≤ 5 | 18.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |