About CID 153339440
CID 153339440 (PubChem CID 153339440) has the molecular formula C74H72F4O6
and a molecular weight of 1133.38 g/mol.
Molecular Properties
| Compound Name | CID 153339440 |
| PubChem CID | 153339440 |
| Molecular Formula | C74H72F4O6 |
| Molecular Weight | 1133.38 g/mol |
| Exact Mass | 1132.53 |
| IUPAC Name | — |
| SMILES | C=C(c1ccc(C(=O)O)cc1)c1cc2c(cc1C)C1(CCC2(C)C)CC1C1CC12CCC(C)(C)c1cc(C(F)C/C=C(\c3ccc(C(=O)O)cc3)c3c(C(C)F)cc4c(c3F)C3(CCC45CC5)CC3)c(C(=C)c3ccc(C(=O)O)cc3)c(F)c12 |
| InChI | InChI=1S/C74H72F4O6/c1-39-33-54-53(34-50(39)40(2)43-9-15-46(16-10-43)66(79)80)69(5,6)23-31-73(54)37-57(73)58-38-74(58)32-24-70(7,8)55-36-52(60(64(77)63(55)74)41(3)44-11-17-47(18-12-44)67(81)82)59(76)22-21-49(45-13-19-48(20-14-45)68(83)84)61-51(42(4)75)35-56-62(65(61)78)72(29-30-72)28-27-71(56)25-26-71/h9-21,33-36,42,57-59H,2-3,22-32,37-38H2,1,4-8H3,(H,79,80)(H,81,82)(H,83,84)/b49-21+ |
| InChIKey | RWQUCGMTCDSCOW-ZFMRUCPMSA-N |
| XLogP | 18.27 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 84 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1133.38 |
| LogP ≤ 5 | 18.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 153339440 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153339440?
The IUPAC name of CID 153339440 (CID 153339440) is not available.
What is the SMILES notation for CID 153339440?
The canonical SMILES for CID 153339440 is C=C(c1ccc(C(=O)O)cc1)c1cc2c(cc1C)C1(CCC2(C)C)CC1C1CC12CCC(C)(C)c1cc(C(F)C/C=C(\c3ccc(C(=O)O)cc3)c3c(C(C)F)cc4c(c3F)C3(CCC45CC5)CC3)c(C(=C)c3ccc(C(=O)O)cc3)c(F)c12.
What is the InChIKey of CID 153339440?
The InChIKey is RWQUCGMTCDSCOW-ZFMRUCPMSA-N. The full InChI is InChI=1S/C74H72F4O6/c1-39-33-54-53(34-50(39)40(2)43-9-15-46(16-10-43)66(79)80)69(5,6)23-31-73(54)37-57(73)58-38-74(58)32-24-70(7,8)55-36-52(60(64(77)63(55)74)41(3)44-11-17-47(18-12-44)67(81)82)59(76)22-21-49(45-13-19-48(20-14-45)68(83)84)61-51(42(4)75)35-56-62(65(61)78)72(29-30-72)28-27-71(56)25-26-71/h9-21,33-36,42,57-59H,2-3,22-32,37-38H2,1,4-8H3,(H,79,80)(H,81,82)(H,83,84)/b49-21+.
What are the key properties of CID 153339440?
CID 153339440 has a molecular weight of 1133.38 g/mol, XLogP of 18.27, 14 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153339440 is sourced from PubChem (CID 153339440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).