C24H24N4O — CID 153340435
4-[[(5E)-5-[(4-cyanophenyl)methylidene]-1-[2-(methylamino)ethyl]-4-oxopiperidin-3-yl]methyl]benzonitrile (PubChem CID 153340435) has the molecular formula C24H24N4O and a molecular weight of 384.48 g/mol. Its IUPAC name is 4-[[(5E)-5-[(4-cyanophenyl)methylidene]-1-[2-(methylamino)ethyl]-4-oxopiperidin-3-yl]methyl]benzonitrile.
| Compound Name | 4-[[(5E)-5-[(4-cyanophenyl)methylidene]-1-[2-(methylamino)ethyl]-4-oxopiperidin-3-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 153340435 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 4-[[(5E)-5-[(4-cyanophenyl)methylidene]-1-[2-(methylamino)ethyl]-4-oxopiperidin-3-yl]methyl]benzonitrile |
| SMILES | CNCCN1C/C(=C\c2ccc(C#N)cc2)C(=O)C(Cc2ccc(C#N)cc2)C1 |
| InChI | InChI=1S/C24H24N4O/c1-27-10-11-28-16-22(12-18-2-6-20(14-25)7-3-18)24(29)23(17-28)13-19-4-8-21(15-26)9-5-19/h2-9,12,23,27H,10-11,13,16-17H2,1H3/b22-12+ |
| InChIKey | FYUHYQVXLGBSIJ-WSDLNYQXSA-N |
| XLogP | 2.78 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|