C27H22N4O5 — CID 155421375
[2-[[2-[(3E,5E)-3,5-bis[(4-cyanophenyl)methylidene]-4-oxopiperidin-1-yl]-2-oxoethyl]amino]-2-oxoethyl] acetate (PubChem CID 155421375) has the molecular formula C27H22N4O5 and a molecular weight of 482.50 g/mol. Its IUPAC name is [2-[[2-[(3E,5E)-3,5-bis[(4-cyanophenyl)methylidene]-4-oxopiperidin-1-yl]-2-oxoethyl]amino]-2-oxoethyl] acetate.
| Compound Name | [2-[[2-[(3E,5E)-3,5-bis[(4-cyanophenyl)methylidene]-4-oxopiperidin-1-yl]-2-oxoethyl]amino]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 155421375 |
| Molecular Formula | C27H22N4O5 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | [2-[[2-[(3E,5E)-3,5-bis[(4-cyanophenyl)methylidene]-4-oxopiperidin-1-yl]-2-oxoethyl]amino]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)NCC(=O)N1C/C(=C\c2ccc(C#N)cc2)C(=O)/C(=C/c2ccc(C#N)cc2)C1 |
| InChI | InChI=1S/C27H22N4O5/c1-18(32)36-17-25(33)30-14-26(34)31-15-23(10-19-2-6-21(12-28)7-3-19)27(35)24(16-31)11-20-4-8-22(13-29)9-5-20/h2-11H,14-17H2,1H3,(H,30,33)/b23-10+,24-11+ |
| InChIKey | HLUCAIBTYIDITJ-HIWNQQMRSA-N |
| XLogP | 1.99 |
| TPSA | 140.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|