C28H31N5O3S — CID 153340430
4-[(E)-[(5E)-1-[3-[3-aminopropyl(methyl)amino]propylsulfonyl]-5-[(4-cyanophenyl)methylidene]-4-oxopiperidin-3-ylidene]methyl]benzonitrile (PubChem CID 153340430) has the molecular formula C28H31N5O3S and a molecular weight of 517.66 g/mol. Its IUPAC name is 4-[(E)-[(5E)-1-[3-[3-aminopropyl(methyl)amino]propylsulfonyl]-5-[(4-cyanophenyl)methylidene]-4-oxopiperidin-3-ylidene]methyl]benzonitrile.
| Compound Name | 4-[(E)-[(5E)-1-[3-[3-aminopropyl(methyl)amino]propylsulfonyl]-5-[(4-cyanophenyl)methylidene]-4-oxopiperidin-3-ylidene]methyl]benzonitrile |
|---|---|
| PubChem CID | 153340430 |
| Molecular Formula | C28H31N5O3S |
| Molecular Weight | 517.66 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | 4-[(E)-[(5E)-1-[3-[3-aminopropyl(methyl)amino]propylsulfonyl]-5-[(4-cyanophenyl)methylidene]-4-oxopiperidin-3-ylidene]methyl]benzonitrile |
| SMILES | CN(CCCN)CCCS(=O)(=O)N1C/C(=C\c2ccc(C#N)cc2)C(=O)/C(=C/c2ccc(C#N)cc2)C1 |
| InChI | InChI=1S/C28H31N5O3S/c1-32(13-2-12-29)14-3-15-37(35,36)33-20-26(16-22-4-8-24(18-30)9-5-22)28(34)27(21-33)17-23-6-10-25(19-31)11-7-23/h4-11,16-17H,2-3,12-15,20-21,29H2,1H3/b26-16+,27-17+ |
| InChIKey | UUHCZZBMGISYHE-CTVDDJEBSA-N |
| XLogP | 2.78 |
| TPSA | 131.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.66 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|