C25H19BrN4O3 — CID 139477313
N-[2-[(3E,5E)-3,5-bis[(4-cyanophenyl)methylidene]-4-oxopiperidin-1-yl]-2-oxoethyl]-2-bromoacetamide (PubChem CID 139477313) has the molecular formula C25H19BrN4O3 and a molecular weight of 503.36 g/mol. Its IUPAC name is N-[2-[(3E,5E)-3,5-bis[(4-cyanophenyl)methylidene]-4-oxopiperidin-1-yl]-2-oxoethyl]-2-bromoacetamide.
| Compound Name | N-[2-[(3E,5E)-3,5-bis[(4-cyanophenyl)methylidene]-4-oxopiperidin-1-yl]-2-oxoethyl]-2-bromoacetamide |
|---|---|
| PubChem CID | 139477313 |
| Molecular Formula | C25H19BrN4O3 |
| Molecular Weight | 503.36 g/mol |
| Exact Mass | 502.06 |
| IUPAC Name | N-[2-[(3E,5E)-3,5-bis[(4-cyanophenyl)methylidene]-4-oxopiperidin-1-yl]-2-oxoethyl]-2-bromoacetamide |
| SMILES | N#Cc1ccc(/C=C2\CN(C(=O)CNC(=O)CBr)C/C(=C\c3ccc(C#N)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H19BrN4O3/c26-11-23(31)29-14-24(32)30-15-21(9-17-1-5-19(12-27)6-2-17)25(33)22(16-30)10-18-3-7-20(13-28)8-4-18/h1-10H,11,14-16H2,(H,29,31)/b21-9+,22-10+ |
| InChIKey | BUVFHNSFKDGNFB-VGENTYGXSA-N |
| XLogP | 2.82 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|