C20H30N4Y2-2 — CID 153343448
3-N-[5-(cyclohexen-1-yl)-4H-pyrimidin-4-id-2-yl]cyclohexa-1,3-diene-1,3-diamine;ethane;bis(yttrium) (PubChem CID 153343448) has the molecular formula C20H30N4Y2-2 and a molecular weight of 504.30 g/mol. Its IUPAC name is 3-N-[5-(cyclohexen-1-yl)-4H-pyrimidin-4-id-2-yl]cyclohexa-1,3-diene-1,3-diamine;ethane;bis(yttrium).
| Compound Name | 3-N-[5-(cyclohexen-1-yl)-4H-pyrimidin-4-id-2-yl]cyclohexa-1,3-diene-1,3-diamine;ethane;bis(yttrium) |
|---|---|
| PubChem CID | 153343448 |
| Molecular Formula | C20H30N4Y2-2 |
| Molecular Weight | 504.30 g/mol |
| Exact Mass | 504.06 |
| IUPAC Name | 3-N-[5-(cyclohexen-1-yl)-4H-pyrimidin-4-id-2-yl]cyclohexa-1,3-diene-1,3-diamine;ethane;bis(yttrium) |
| SMILES | CC.CC.NC1=CC(Nc2n[c-]c(C3=CCCCC3)cn2)=[C-]CC1.[Y].[Y] |
| InChI | InChI=1S/C16H18N4.2C2H6.2Y/c17-14-7-4-8-15(9-14)20-16-18-10-13(11-19-16)12-5-2-1-3-6-12;2*1-2;;/h5,9-10H,1-4,6-7,17H2,(H,18,19,20);2*1-2H3;;/q-2;;;; |
| InChIKey | UHZPKWTTZSRCFG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.30 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|