C19H26N4Y2-2 — CID 153343443
(2E)-4-N-[5-(cyclohexen-1-yl)-4H-pyrimidin-4-id-2-yl]hepta-2,4,6-triene-2,4-diamine;ethane;bis(yttrium) (PubChem CID 153343443) has the molecular formula C19H26N4Y2-2 and a molecular weight of 488.26 g/mol. Its IUPAC name is (2E)-4-N-[5-(cyclohexen-1-yl)-4H-pyrimidin-4-id-2-yl]hepta-2,4,6-triene-2,4-diamine;ethane;bis(yttrium).
| Compound Name | (2E)-4-N-[5-(cyclohexen-1-yl)-4H-pyrimidin-4-id-2-yl]hepta-2,4,6-triene-2,4-diamine;ethane;bis(yttrium) |
|---|---|
| PubChem CID | 153343443 |
| Molecular Formula | C19H26N4Y2-2 |
| Molecular Weight | 488.26 g/mol |
| Exact Mass | 488.03 |
| IUPAC Name | (2E)-4-N-[5-(cyclohexen-1-yl)-4H-pyrimidin-4-id-2-yl]hepta-2,4,6-triene-2,4-diamine;ethane;bis(yttrium) |
| SMILES | C=C/[C-]=C(\C=C(/C)N)Nc1n[c-]c(C2=CCCCC2)cn1.CC.[Y].[Y] |
| InChI | InChI=1S/C17H20N4.C2H6.2Y/c1-3-7-16(10-13(2)18)21-17-19-11-15(12-20-17)14-8-5-4-6-9-14;1-2;;/h3,8,10-11H,1,4-6,9,18H2,2H3,(H,19,20,21);1-2H3;;/q-2;;;/b13-10+;;; |
| InChIKey | UIUXBVHMESBQAB-SAOBJNJYSA-N |
| XLogP | 4.40 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.26 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|