C21H28N4Y2-2 — CID 153343461
(3E)-5-N-[5-(cyclohexen-1-ylmethyl)-4H-pyrimidin-4-id-2-yl]octa-1,3,5,7-tetraene-3,5-diamine;ethane;bis(yttrium) (PubChem CID 153343461) has the molecular formula C21H28N4Y2-2 and a molecular weight of 514.30 g/mol. Its IUPAC name is (3E)-5-N-[5-(cyclohexen-1-ylmethyl)-4H-pyrimidin-4-id-2-yl]octa-1,3,5,7-tetraene-3,5-diamine;ethane;bis(yttrium).
| Compound Name | (3E)-5-N-[5-(cyclohexen-1-ylmethyl)-4H-pyrimidin-4-id-2-yl]octa-1,3,5,7-tetraene-3,5-diamine;ethane;bis(yttrium) |
|---|---|
| PubChem CID | 153343461 |
| Molecular Formula | C21H28N4Y2-2 |
| Molecular Weight | 514.30 g/mol |
| Exact Mass | 514.04 |
| IUPAC Name | (3E)-5-N-[5-(cyclohexen-1-ylmethyl)-4H-pyrimidin-4-id-2-yl]octa-1,3,5,7-tetraene-3,5-diamine;ethane;bis(yttrium) |
| SMILES | C=C/[C-]=C(\C=C(\N)C=C)Nc1n[c-]c(CC2=CCCCC2)cn1.CC.[Y].[Y] |
| InChI | InChI=1S/C19H22N4.C2H6.2Y/c1-3-8-18(12-17(20)4-2)23-19-21-13-16(14-22-19)11-15-9-6-5-7-10-15;1-2;;/h3-4,9,12-13H,1-2,5-7,10-11,20H2,(H,21,22,23);1-2H3;;/q-2;;;/b17-12+;;; |
| InChIKey | TXRJQESYZQQCJP-DPSBJRLESA-N |
| XLogP | 4.65 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.30 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|