C14H25NS — CID 153344118
ethane;N-[(2E,4Z)-2-[(Z)-prop-1-enyl]hexa-2,4-dienyl]propanethioamide (PubChem CID 153344118) has the molecular formula C14H25NS and a molecular weight of 239.43 g/mol. Its IUPAC name is ethane;N-[(2E,4Z)-2-[(Z)-prop-1-enyl]hexa-2,4-dienyl]propanethioamide.
| Compound Name | ethane;N-[(2E,4Z)-2-[(Z)-prop-1-enyl]hexa-2,4-dienyl]propanethioamide |
|---|---|
| PubChem CID | 153344118 |
| Molecular Formula | C14H25NS |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | ethane;N-[(2E,4Z)-2-[(Z)-prop-1-enyl]hexa-2,4-dienyl]propanethioamide |
| SMILES | C/C=C\C=C(/C=C\C)CNC(=S)CC.CC |
| InChI | InChI=1S/C12H19NS.C2H6/c1-4-7-9-11(8-5-2)10-13-12(14)6-3;1-2/h4-5,7-9H,6,10H2,1-3H3,(H,13,14);1-2H3/b7-4-,8-5-,11-9+; |
| InChIKey | IDCFPVUEEAGNLO-SPAPVVPNSA-N |
| XLogP | 4.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|