C12H21N — CID 139250145
(2E,4E)-6-methyl-N-(2-methylprop-2-enyl)hepta-2,4-dien-1-amine (PubChem CID 139250145) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (2E,4E)-6-methyl-N-(2-methylprop-2-enyl)hepta-2,4-dien-1-amine.
| Compound Name | (2E,4E)-6-methyl-N-(2-methylprop-2-enyl)hepta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 139250145 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (2E,4E)-6-methyl-N-(2-methylprop-2-enyl)hepta-2,4-dien-1-amine |
| SMILES | C=C(C)CNC/C=C/C=C/C(C)C |
| InChI | InChI=1S/C12H21N/c1-11(2)8-6-5-7-9-13-10-12(3)4/h5-8,11,13H,3,9-10H2,1-2,4H3/b7-5+,8-6+ |
| InChIKey | BWZWZHWKTCVRDG-KQQUZDAGSA-N |
| XLogP | 2.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|