C11H17NS — CID 153344163
N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]propanethioamide (PubChem CID 153344163) has the molecular formula C11H17NS and a molecular weight of 195.33 g/mol. Its IUPAC name is N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]propanethioamide.
| Compound Name | N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]propanethioamide |
|---|---|
| PubChem CID | 153344163 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | N-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]propanethioamide |
| SMILES | C=C/C=C(\C=C/C)CNC(=S)CC |
| InChI | InChI=1S/C11H17NS/c1-4-7-10(8-5-2)9-12-11(13)6-3/h4-5,7-8H,1,6,9H2,2-3H3,(H,12,13)/b8-5-,10-7+ |
| InChIKey | RKRONVOPDARZDH-OEPUHGBTSA-N |
| XLogP | 3.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|