C14H28N2O — CID 153344253
ethane;N-[(E)-2-ethenyl-4-methyliminobut-2-enyl]acetamide;propane (PubChem CID 153344253) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is ethane;N-[(E)-2-ethenyl-4-methyliminobut-2-enyl]acetamide;propane.
| Compound Name | ethane;N-[(E)-2-ethenyl-4-methyliminobut-2-enyl]acetamide;propane |
|---|---|
| PubChem CID | 153344253 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | ethane;N-[(E)-2-ethenyl-4-methyliminobut-2-enyl]acetamide;propane |
| SMILES | C=C/C(=C\C=N\C)CNC(C)=O.CC.CCC |
| InChI | InChI=1S/C9H14N2O.C3H8.C2H6/c1-4-9(5-6-10-3)7-11-8(2)12;1-3-2;1-2/h4-6H,1,7H2,2-3H3,(H,11,12);3H2,1-2H3;1-2H3/b9-5+,10-6+;; |
| InChIKey | GBJMTHUYHMGUOW-ODPWVAJHSA-N |
| XLogP | 3.38 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|