C26H43NO — CID 153344723
(3Z)-3-amino-3-[(3E,4Z)-3,4-di(ethylidene)-1-methylidenenaphthalen-2-ylidene]prop-1-en-2-ol;ethane (PubChem CID 153344723) has the molecular formula C26H43NO and a molecular weight of 385.64 g/mol. Its IUPAC name is (3Z)-3-amino-3-[(3E,4Z)-3,4-di(ethylidene)-1-methylidenenaphthalen-2-ylidene]prop-1-en-2-ol;ethane.
| Compound Name | (3Z)-3-amino-3-[(3E,4Z)-3,4-di(ethylidene)-1-methylidenenaphthalen-2-ylidene]prop-1-en-2-ol;ethane |
|---|---|
| PubChem CID | 153344723 |
| Molecular Formula | C26H43NO |
| Molecular Weight | 385.64 g/mol |
| Exact Mass | 385.33 |
| IUPAC Name | (3Z)-3-amino-3-[(3E,4Z)-3,4-di(ethylidene)-1-methylidenenaphthalen-2-ylidene]prop-1-en-2-ol;ethane |
| SMILES | C=C(O)/C(N)=c1\c(=C)c2ccccc2c(=C/C)/c1=C\C.CC.CC.CC.CC |
| InChI | InChI=1S/C18H19NO.4C2H6/c1-5-13-14(6-2)17(18(19)12(4)20)11(3)15-9-7-8-10-16(13)15;4*1-2/h5-10,20H,3-4,19H2,1-2H3;4*1-2H3/b13-5+,14-6+,18-17-;;;; |
| InChIKey | HBIABFOMJAPOIH-ALWVOPHPSA-N |
| XLogP | 5.09 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.64 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|