C54H34N4S — CID 153344895
16-[3-[3-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-8-thia-6-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene (PubChem CID 153344895) has the molecular formula C54H34N4S and a molecular weight of 770.96 g/mol. Its IUPAC name is 16-[3-[3-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-8-thia-6-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene.
| Compound Name | 16-[3-[3-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-8-thia-6-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene |
|---|---|
| PubChem CID | 153344895 |
| Molecular Formula | C54H34N4S |
| Molecular Weight | 770.96 g/mol |
| Exact Mass | 770.25 |
| IUPAC Name | 16-[3-[3-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]phenyl]-8-thia-6-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4cccc(-c5cccc(-c6ccc7cccc8c7c6-c6cccnc6S8)c5)c4)n3)cc2)cc1 |
| InChI | InChI=1S/C54H34N4S/c1-3-11-35(12-4-1)37-22-26-40(27-23-37)51-56-52(41-28-24-38(25-29-41)36-13-5-2-6-14-36)58-53(57-51)45-19-8-17-43(34-45)42-16-7-18-44(33-42)46-31-30-39-15-9-21-48-49(39)50(46)47-20-10-32-55-54(47)59-48/h1-34H |
| InChIKey | CEISQNCIKBCXHG-UHFFFAOYSA-N |
| XLogP | 14.22 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.96 |
| LogP ≤ 5 | 14.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |