C13H24O7 — CID 153348423
2-[(E,3S)-3-hydroxyhept-4-enoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 153348423) has the molecular formula C13H24O7 and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-[(E,3S)-3-hydroxyhept-4-enoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[(E,3S)-3-hydroxyhept-4-enoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 153348423 |
| Molecular Formula | C13H24O7 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-[(E,3S)-3-hydroxyhept-4-enoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC/C=C/[C@@H](O)CCOC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C13H24O7/c1-2-3-4-8(15)5-6-19-13-12(18)11(17)10(16)9(7-14)20-13/h3-4,8-18H,2,5-7H2,1H3/b4-3+/t8-,9?,10?,11?,12?,13?/m1/s1 |
| InChIKey | XIVDAKAHKSDNDT-OZRKZLIESA-N |
| XLogP | -1.48 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|