C27H33N7O — CID 153348690
2-[3-[3-(tert-butylamino)pyrrolidin-1-yl]-5-ethyl-4H-diazepin-7-yl]-5-(triazolo[1,5-a]pyridin-5-yl)phenol (PubChem CID 153348690) has the molecular formula C27H33N7O and a molecular weight of 471.61 g/mol. Its IUPAC name is 2-[3-[3-(tert-butylamino)pyrrolidin-1-yl]-5-ethyl-4H-diazepin-7-yl]-5-(triazolo[1,5-a]pyridin-5-yl)phenol.
| Compound Name | 2-[3-[3-(tert-butylamino)pyrrolidin-1-yl]-5-ethyl-4H-diazepin-7-yl]-5-(triazolo[1,5-a]pyridin-5-yl)phenol |
|---|---|
| PubChem CID | 153348690 |
| Molecular Formula | C27H33N7O |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | 2-[3-[3-(tert-butylamino)pyrrolidin-1-yl]-5-ethyl-4H-diazepin-7-yl]-5-(triazolo[1,5-a]pyridin-5-yl)phenol |
| SMILES | CCC1=CC(c2ccc(-c3ccn4nncc4c3)cc2O)=NN=C(N2CCC(NC(C)(C)C)C2)C1 |
| InChI | InChI=1S/C27H33N7O/c1-5-18-12-24(30-31-26(13-18)33-10-9-21(17-33)29-27(2,3)4)23-7-6-19(15-25(23)35)20-8-11-34-22(14-20)16-28-32-34/h6-8,11-12,14-16,21,29,35H,5,9-10,13,17H2,1-4H3 |
| InChIKey | VBUDHXHSPFHFSZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|