C24H32N6O — CID 156887595
2-(5-ethyl-3-piperazin-1-yl-4H-diazepin-7-yl)-5-(5-methyl-1-propylpyrazol-4-yl)phenol (PubChem CID 156887595) has the molecular formula C24H32N6O and a molecular weight of 420.56 g/mol. Its IUPAC name is 2-(5-ethyl-3-piperazin-1-yl-4H-diazepin-7-yl)-5-(5-methyl-1-propylpyrazol-4-yl)phenol.
| Compound Name | 2-(5-ethyl-3-piperazin-1-yl-4H-diazepin-7-yl)-5-(5-methyl-1-propylpyrazol-4-yl)phenol |
|---|---|
| PubChem CID | 156887595 |
| Molecular Formula | C24H32N6O |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | 2-(5-ethyl-3-piperazin-1-yl-4H-diazepin-7-yl)-5-(5-methyl-1-propylpyrazol-4-yl)phenol |
| SMILES | CCCn1ncc(-c2ccc(C3=NN=C(N4CCNCC4)CC(CC)=C3)c(O)c2)c1C |
| InChI | InChI=1S/C24H32N6O/c1-4-10-30-17(3)21(16-26-30)19-6-7-20(23(31)15-19)22-13-18(5-2)14-24(28-27-22)29-11-8-25-9-12-29/h6-7,13,15-16,25,31H,4-5,8-12,14H2,1-3H3 |
| InChIKey | VDEWYPRGNMOAFN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 78.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|